C25H24FN9O3 — CID 118571871
1-[3-[2-[(1S)-1-[(6-amino-5-cyanopyrimidin-4-yl)amino]ethyl]-8-fluoro-4-oxoquinazolin-3-yl]phenyl]-3-(3-hydroxypropyl)urea (PubChem CID 118571871) has the molecular formula C25H24FN9O3 and a molecular weight of 517.53 g/mol. Its IUPAC name is 1-[3-[2-[(1S)-1-[(6-amino-5-cyanopyrimidin-4-yl)amino]ethyl]-8-fluoro-4-oxoquinazolin-3-yl]phenyl]-3-(3-hydroxypropyl)urea.
| Compound Name | 1-[3-[2-[(1S)-1-[(6-amino-5-cyanopyrimidin-4-yl)amino]ethyl]-8-fluoro-4-oxoquinazolin-3-yl]phenyl]-3-(3-hydroxypropyl)urea |
|---|---|
| PubChem CID | 118571871 |
| Molecular Formula | C25H24FN9O3 |
| Molecular Weight | 517.53 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | 1-[3-[2-[(1S)-1-[(6-amino-5-cyanopyrimidin-4-yl)amino]ethyl]-8-fluoro-4-oxoquinazolin-3-yl]phenyl]-3-(3-hydroxypropyl)urea |
| SMILES | C[C@H](Nc1ncnc(N)c1C#N)c1nc2c(F)cccc2c(=O)n1-c1cccc(NC(=O)NCCCO)c1 |
| InChI | InChI=1S/C25H24FN9O3/c1-14(32-22-18(12-27)21(28)30-13-31-22)23-34-20-17(7-3-8-19(20)26)24(37)35(23)16-6-2-5-15(11-16)33-25(38)29-9-4-10-36/h2-3,5-8,11,13-14,36H,4,9-10H2,1H3,(H2,29,33,38)(H3,28,30,31,32)/t14-/m0/s1 |
| InChIKey | GQJUSOYVVNNVTK-AWEZNQCLSA-N |
| XLogP | 2.45 |
| TPSA | 183.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.53 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|