C16H12F2IN3O — CID 90235932
2-[(1S)-1-aminoethyl]-3-(3,5-difluorophenyl)-8-iodoquinazolin-4-one (PubChem CID 90235932) has the molecular formula C16H12F2IN3O and a molecular weight of 427.19 g/mol. Its IUPAC name is 2-[(1S)-1-aminoethyl]-3-(3,5-difluorophenyl)-8-iodoquinazolin-4-one.
| Compound Name | 2-[(1S)-1-aminoethyl]-3-(3,5-difluorophenyl)-8-iodoquinazolin-4-one |
|---|---|
| PubChem CID | 90235932 |
| Molecular Formula | C16H12F2IN3O |
| Molecular Weight | 427.19 g/mol |
| Exact Mass | 427.00 |
| IUPAC Name | 2-[(1S)-1-aminoethyl]-3-(3,5-difluorophenyl)-8-iodoquinazolin-4-one |
| SMILES | C[C@H](N)c1nc2c(I)cccc2c(=O)n1-c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C16H12F2IN3O/c1-8(20)15-21-14-12(3-2-4-13(14)19)16(23)22(15)11-6-9(17)5-10(18)7-11/h2-8H,20H2,1H3/t8-/m0/s1 |
| InChIKey | CDNBGTVPOOKFHK-QMMMGPOBSA-N |
| XLogP | 3.29 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.19 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|