C16H12ClF2N3O — CID 90235637
2-[(1S)-1-aminoethyl]-8-chloro-3-(3,5-difluorophenyl)quinazolin-4-one (PubChem CID 90235637) has the molecular formula C16H12ClF2N3O and a molecular weight of 335.74 g/mol. Its IUPAC name is 2-[(1S)-1-aminoethyl]-8-chloro-3-(3,5-difluorophenyl)quinazolin-4-one.
| Compound Name | 2-[(1S)-1-aminoethyl]-8-chloro-3-(3,5-difluorophenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 90235637 |
| Molecular Formula | C16H12ClF2N3O |
| Molecular Weight | 335.74 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 2-[(1S)-1-aminoethyl]-8-chloro-3-(3,5-difluorophenyl)quinazolin-4-one |
| SMILES | C[C@H](N)c1nc2c(Cl)cccc2c(=O)n1-c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C16H12ClF2N3O/c1-8(20)15-21-14-12(3-2-4-13(14)17)16(23)22(15)11-6-9(18)5-10(19)7-11/h2-8H,20H2,1H3/t8-/m0/s1 |
| InChIKey | WTCNVNYBPFXXSK-QMMMGPOBSA-N |
| XLogP | 3.34 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.74 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |