C20H21F2N5O — CID 123957042
N'-[[1-[3-(3,5-difluorophenyl)-8-ethyl-4-oxoquinazolin-2-yl]ethylamino]methyl]methanimidamide (PubChem CID 123957042) has the molecular formula C20H21F2N5O and a molecular weight of 385.42 g/mol. Its IUPAC name is N'-[[1-[3-(3,5-difluorophenyl)-8-ethyl-4-oxoquinazolin-2-yl]ethylamino]methyl]methanimidamide.
| Compound Name | N'-[[1-[3-(3,5-difluorophenyl)-8-ethyl-4-oxoquinazolin-2-yl]ethylamino]methyl]methanimidamide |
|---|---|
| PubChem CID | 123957042 |
| Molecular Formula | C20H21F2N5O |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | N'-[[1-[3-(3,5-difluorophenyl)-8-ethyl-4-oxoquinazolin-2-yl]ethylamino]methyl]methanimidamide |
| SMILES | CCc1cccc2c(=O)n(-c3cc(F)cc(F)c3)c(C(C)NCN=CN)nc12 |
| InChI | InChI=1S/C20H21F2N5O/c1-3-13-5-4-6-17-18(13)26-19(12(2)25-11-24-10-23)27(20(17)28)16-8-14(21)7-15(22)9-16/h4-10,12,25H,3,11H2,1-2H3,(H2,23,24) |
| InChIKey | DBJYSEYFLBFEMQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|