C21H22FN3O3 — CID 118276359
tert-butyl-[(1S)-1-(8-fluoro-4-oxo-3-phenylquinazolin-2-yl)ethyl]carbamic acid (PubChem CID 118276359) has the molecular formula C21H22FN3O3 and a molecular weight of 383.42 g/mol. Its IUPAC name is tert-butyl-[(1S)-1-(8-fluoro-4-oxo-3-phenylquinazolin-2-yl)ethyl]carbamic acid.
| Compound Name | tert-butyl-[(1S)-1-(8-fluoro-4-oxo-3-phenylquinazolin-2-yl)ethyl]carbamic acid |
|---|---|
| PubChem CID | 118276359 |
| Molecular Formula | C21H22FN3O3 |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | tert-butyl-[(1S)-1-(8-fluoro-4-oxo-3-phenylquinazolin-2-yl)ethyl]carbamic acid |
| SMILES | C[C@@H](c1nc2c(F)cccc2c(=O)n1-c1ccccc1)N(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C21H22FN3O3/c1-13(25(20(27)28)21(2,3)4)18-23-17-15(11-8-12-16(17)22)19(26)24(18)14-9-6-5-7-10-14/h5-13H,1-4H3,(H,27,28)/t13-/m0/s1 |
| InChIKey | SUZHZIMKBXXTTH-ZDUSSCGKSA-N |
| XLogP | 4.36 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |