C22H21FN4O3 — CID 118276382
tert-butyl-[1-[3-(3-cyanophenyl)-5-fluoro-4-oxoquinazolin-2-yl]ethyl]carbamic acid (PubChem CID 118276382) has the molecular formula C22H21FN4O3 and a molecular weight of 408.43 g/mol. Its IUPAC name is tert-butyl-[1-[3-(3-cyanophenyl)-5-fluoro-4-oxoquinazolin-2-yl]ethyl]carbamic acid.
| Compound Name | tert-butyl-[1-[3-(3-cyanophenyl)-5-fluoro-4-oxoquinazolin-2-yl]ethyl]carbamic acid |
|---|---|
| PubChem CID | 118276382 |
| Molecular Formula | C22H21FN4O3 |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | tert-butyl-[1-[3-(3-cyanophenyl)-5-fluoro-4-oxoquinazolin-2-yl]ethyl]carbamic acid |
| SMILES | CC(c1nc2cccc(F)c2c(=O)n1-c1cccc(C#N)c1)N(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C22H21FN4O3/c1-13(27(21(29)30)22(2,3)4)19-25-17-10-6-9-16(23)18(17)20(28)26(19)15-8-5-7-14(11-15)12-24/h5-11,13H,1-4H3,(H,29,30) |
| InChIKey | LLLNRCARWOEFJW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |