C17H17Cl2N3O — CID 155191424
2-(1-aminopropyl)-5-chloro-3-phenylquinazolin-4-one;hydrochloride (PubChem CID 155191424) has the molecular formula C17H17Cl2N3O and a molecular weight of 350.25 g/mol. Its IUPAC name is 2-(1-aminopropyl)-5-chloro-3-phenylquinazolin-4-one;hydrochloride.
| Compound Name | 2-(1-aminopropyl)-5-chloro-3-phenylquinazolin-4-one;hydrochloride |
|---|---|
| PubChem CID | 155191424 |
| Molecular Formula | C17H17Cl2N3O |
| Molecular Weight | 350.25 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 2-(1-aminopropyl)-5-chloro-3-phenylquinazolin-4-one;hydrochloride |
| SMILES | CCC(N)c1nc2cccc(Cl)c2c(=O)n1-c1ccccc1.Cl |
| InChI | InChI=1S/C17H16ClN3O.ClH/c1-2-13(19)16-20-14-10-6-9-12(18)15(14)17(22)21(16)11-7-4-3-5-8-11;/h3-10,13H,2,19H2,1H3;1H |
| InChIKey | IWFIUQFQKOMZMT-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.25 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |