C23H20ClN5O — CID 144954490
4-amino-6-methylpyridine-3-carbonitrile;5-chloro-2-ethyl-3-phenylquinazolin-4-one (PubChem CID 144954490) has the molecular formula C23H20ClN5O and a molecular weight of 417.90 g/mol. Its IUPAC name is 4-amino-6-methylpyridine-3-carbonitrile;5-chloro-2-ethyl-3-phenylquinazolin-4-one.
| Compound Name | 4-amino-6-methylpyridine-3-carbonitrile;5-chloro-2-ethyl-3-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 144954490 |
| Molecular Formula | C23H20ClN5O |
| Molecular Weight | 417.90 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 4-amino-6-methylpyridine-3-carbonitrile;5-chloro-2-ethyl-3-phenylquinazolin-4-one |
| SMILES | CCc1nc2cccc(Cl)c2c(=O)n1-c1ccccc1.Cc1cc(N)c(C#N)cn1 |
| InChI | InChI=1S/C16H13ClN2O.C7H7N3/c1-2-14-18-13-10-6-9-12(17)15(13)16(20)19(14)11-7-4-3-5-8-11;1-5-2-7(9)6(3-8)4-10-5/h3-10H,2H2,1H3;2,4H,1H3,(H2,9,10) |
| InChIKey | RHXNLWSQWQLYIE-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 97.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.90 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |