C23H19FN6O2 — CID 144824495
3-aminopyrazine-2-carboxamide;2-ethyl-5-ethynyl-3-(4-fluorophenyl)quinazolin-4-one (PubChem CID 144824495) has the molecular formula C23H19FN6O2 and a molecular weight of 430.44 g/mol. Its IUPAC name is 3-aminopyrazine-2-carboxamide;2-ethyl-5-ethynyl-3-(4-fluorophenyl)quinazolin-4-one.
| Compound Name | 3-aminopyrazine-2-carboxamide;2-ethyl-5-ethynyl-3-(4-fluorophenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 144824495 |
| Molecular Formula | C23H19FN6O2 |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 3-aminopyrazine-2-carboxamide;2-ethyl-5-ethynyl-3-(4-fluorophenyl)quinazolin-4-one |
| SMILES | C#Cc1cccc2nc(CC)n(-c3ccc(F)cc3)c(=O)c12.NC(=O)c1nccnc1N |
| InChI | InChI=1S/C18H13FN2O.C5H6N4O/c1-3-12-6-5-7-15-17(12)18(22)21(16(4-2)20-15)14-10-8-13(19)9-11-14;6-4-3(5(7)10)8-1-2-9-4/h1,5-11H,4H2,2H3;1-2H,(H2,6,9)(H2,7,10) |
| InChIKey | NHFFVORBRXETTM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 129.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|