C24H19FN5O2+ — CID 149344247
3-amino-N-[1-[8-ethynyl-2-(4-fluorophenyl)-1-oxoisoquinolin-3-yl]ethyl]pyrazin-4-ium-2-carboxamide (PubChem CID 149344247) has the molecular formula C24H19FN5O2+ and a molecular weight of 428.45 g/mol. Its IUPAC name is 3-amino-N-[1-[8-ethynyl-2-(4-fluorophenyl)-1-oxoisoquinolin-3-yl]ethyl]pyrazin-4-ium-2-carboxamide.
| Compound Name | 3-amino-N-[1-[8-ethynyl-2-(4-fluorophenyl)-1-oxoisoquinolin-3-yl]ethyl]pyrazin-4-ium-2-carboxamide |
|---|---|
| PubChem CID | 149344247 |
| Molecular Formula | C24H19FN5O2+ |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 3-amino-N-[1-[8-ethynyl-2-(4-fluorophenyl)-1-oxoisoquinolin-3-yl]ethyl]pyrazin-4-ium-2-carboxamide |
| SMILES | C#Cc1cccc2cc(C(C)NC(=O)c3ncc[nH+]c3N)n(-c3ccc(F)cc3)c(=O)c12 |
| InChI | InChI=1S/C24H18FN5O2/c1-3-15-5-4-6-16-13-19(14(2)29-23(31)21-22(26)28-12-11-27-21)30(24(32)20(15)16)18-9-7-17(25)8-10-18/h1,4-14H,2H3,(H2,26,28)(H,29,31)/p+1 |
| InChIKey | YETLOLVHMKLKMB-UHFFFAOYSA-O |
| XLogP | 2.39 |
| TPSA | 104.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|