C24H18N6O — CID 71505693
2-amino-4-[[(1S)-1-(8-ethynyl-1-oxo-2-phenylisoquinolin-3-yl)ethyl]amino]pyrimidine-5-carbonitrile (PubChem CID 71505693) has the molecular formula C24H18N6O and a molecular weight of 406.45 g/mol. Its IUPAC name is 2-amino-4-[[(1S)-1-(8-ethynyl-1-oxo-2-phenylisoquinolin-3-yl)ethyl]amino]pyrimidine-5-carbonitrile.
| Compound Name | 2-amino-4-[[(1S)-1-(8-ethynyl-1-oxo-2-phenylisoquinolin-3-yl)ethyl]amino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 71505693 |
| Molecular Formula | C24H18N6O |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 2-amino-4-[[(1S)-1-(8-ethynyl-1-oxo-2-phenylisoquinolin-3-yl)ethyl]amino]pyrimidine-5-carbonitrile |
| SMILES | C#Cc1cccc2cc([C@H](C)Nc3nc(N)ncc3C#N)n(-c3ccccc3)c(=O)c12 |
| InChI | InChI=1S/C24H18N6O/c1-3-16-8-7-9-17-12-20(15(2)28-22-18(13-25)14-27-24(26)29-22)30(23(31)21(16)17)19-10-5-4-6-11-19/h1,4-12,14-15H,2H3,(H3,26,27,28,29)/t15-/m0/s1 |
| InChIKey | IVGCRCFKBPTBRJ-HNNXBMFYSA-N |
| XLogP | 3.39 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|