C25H20N6O — CID 78047176
2-amino-4-[1-(1-oxo-2-phenyl-8-prop-1-ynylisoquinolin-3-yl)ethylamino]pyrimidine-5-carbonitrile (PubChem CID 78047176) has the molecular formula C25H20N6O and a molecular weight of 420.48 g/mol. Its IUPAC name is 2-amino-4-[1-(1-oxo-2-phenyl-8-prop-1-ynylisoquinolin-3-yl)ethylamino]pyrimidine-5-carbonitrile.
| Compound Name | 2-amino-4-[1-(1-oxo-2-phenyl-8-prop-1-ynylisoquinolin-3-yl)ethylamino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 78047176 |
| Molecular Formula | C25H20N6O |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | 2-amino-4-[1-(1-oxo-2-phenyl-8-prop-1-ynylisoquinolin-3-yl)ethylamino]pyrimidine-5-carbonitrile |
| SMILES | CC#Cc1cccc2cc(C(C)Nc3nc(N)ncc3C#N)n(-c3ccccc3)c(=O)c12 |
| InChI | InChI=1S/C25H20N6O/c1-3-8-17-9-7-10-18-13-21(16(2)29-23-19(14-26)15-28-25(27)30-23)31(24(32)22(17)18)20-11-5-4-6-12-20/h4-7,9-13,15-16H,1-2H3,(H3,27,28,29,30) |
| InChIKey | RTFSBPZHAMPFJO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|