C15H12N4O — CID 145057621
6-ethyl-3-ethynyl-5-phenyl-2H-pyrazolo[3,4-d]pyrimidin-4-one (PubChem CID 145057621) has the molecular formula C15H12N4O and a molecular weight of 264.29 g/mol. Its IUPAC name is 6-ethyl-3-ethynyl-5-phenyl-2H-pyrazolo[3,4-d]pyrimidin-4-one.
| Compound Name | 6-ethyl-3-ethynyl-5-phenyl-2H-pyrazolo[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 145057621 |
| Molecular Formula | C15H12N4O |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 6-ethyl-3-ethynyl-5-phenyl-2H-pyrazolo[3,4-d]pyrimidin-4-one |
| SMILES | C#Cc1[nH]nc2nc(CC)n(-c3ccccc3)c(=O)c12 |
| InChI | InChI=1S/C15H12N4O/c1-3-11-13-14(18-17-11)16-12(4-2)19(15(13)20)10-8-6-5-7-9-10/h1,5-9H,4H2,2H3,(H,17,18) |
| InChIKey | GTJAHBFRACRQQU-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|