C23H16N2O2S2 — CID 4887767
3-(1-phenylethyl)-2-thiophen-2-ylthiochromeno[2,3-d]pyrimidine-4,5-dione (PubChem CID 4887767) has the molecular formula C23H16N2O2S2 and a molecular weight of 416.53 g/mol. Its IUPAC name is 3-(1-phenylethyl)-2-thiophen-2-ylthiochromeno[2,3-d]pyrimidine-4,5-dione.
| Compound Name | 3-(1-phenylethyl)-2-thiophen-2-ylthiochromeno[2,3-d]pyrimidine-4,5-dione |
|---|---|
| PubChem CID | 4887767 |
| Molecular Formula | C23H16N2O2S2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | 3-(1-phenylethyl)-2-thiophen-2-ylthiochromeno[2,3-d]pyrimidine-4,5-dione |
| SMILES | CC(c1ccccc1)n1c(-c2cccs2)nc2sc3ccccc3c(=O)c2c1=O |
| InChI | InChI=1S/C23H16N2O2S2/c1-14(15-8-3-2-4-9-15)25-21(18-12-7-13-28-18)24-22-19(23(25)27)20(26)16-10-5-6-11-17(16)29-22/h2-14H,1H3 |
| InChIKey | SPVSWGJXLYFMNQ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|