C21H21ClN4 — CID 171375722
2,3-bis(4-methylphenyl)-5-phenyl-1H-tetrazole;hydrochloride (PubChem CID 171375722) has the molecular formula C21H21ClN4 and a molecular weight of 364.88 g/mol. Its IUPAC name is 2,3-bis(4-methylphenyl)-5-phenyl-1H-tetrazole;hydrochloride.
| Compound Name | 2,3-bis(4-methylphenyl)-5-phenyl-1H-tetrazole;hydrochloride |
|---|---|
| PubChem CID | 171375722 |
| Molecular Formula | C21H21ClN4 |
| Molecular Weight | 364.88 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 2,3-bis(4-methylphenyl)-5-phenyl-1H-tetrazole;hydrochloride |
| SMILES | Cc1ccc(N2N=C(c3ccccc3)NN2c2ccc(C)cc2)cc1.Cl |
| InChI | InChI=1S/C21H20N4.ClH/c1-16-8-12-19(13-9-16)24-22-21(18-6-4-3-5-7-18)23-25(24)20-14-10-17(2)11-15-20;/h3-15H,1-2H3,(H,22,23);1H |
| InChIKey | IYIJNMGGEGVHKF-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.88 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |