C21H17N3S — CID 14930639
4-(4-methylphenyl)-2,6-diphenyl-1,3,4,5-thiatriazine (PubChem CID 14930639) has the molecular formula C21H17N3S and a molecular weight of 343.46 g/mol. Its IUPAC name is 4-(4-methylphenyl)-2,6-diphenyl-1,3,4,5-thiatriazine.
| Compound Name | 4-(4-methylphenyl)-2,6-diphenyl-1,3,4,5-thiatriazine |
|---|---|
| PubChem CID | 14930639 |
| Molecular Formula | C21H17N3S |
| Molecular Weight | 343.46 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 4-(4-methylphenyl)-2,6-diphenyl-1,3,4,5-thiatriazine |
| SMILES | Cc1ccc(N2N=C(c3ccccc3)SC(c3ccccc3)=N2)cc1 |
| InChI | InChI=1S/C21H17N3S/c1-16-12-14-19(15-13-16)24-22-20(17-8-4-2-5-9-17)25-21(23-24)18-10-6-3-7-11-18/h2-15H,1H3 |
| InChIKey | LAMKQPNCCZUEIQ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.46 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |