C23H20N2OS — CID 3347681
5-(4-methoxyphenyl)-6-methyl-2,4-diphenyl-1,3,4-thiadiazine (PubChem CID 3347681) has the molecular formula C23H20N2OS and a molecular weight of 372.49 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-6-methyl-2,4-diphenyl-1,3,4-thiadiazine.
| Compound Name | 5-(4-methoxyphenyl)-6-methyl-2,4-diphenyl-1,3,4-thiadiazine |
|---|---|
| PubChem CID | 3347681 |
| Molecular Formula | C23H20N2OS |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 5-(4-methoxyphenyl)-6-methyl-2,4-diphenyl-1,3,4-thiadiazine |
| SMILES | COc1ccc(C2=C(C)SC(c3ccccc3)=NN2c2ccccc2)cc1 |
| InChI | InChI=1S/C23H20N2OS/c1-17-22(18-13-15-21(26-2)16-14-18)25(20-11-7-4-8-12-20)24-23(27-17)19-9-5-3-6-10-19/h3-16H,1-2H3 |
| InChIKey | PRVIJULTGCGMFU-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |