C13H11ClN2O6S — CID 134922319
(1S,5R,6R,7R)-7-chloro-6-(2,4-dinitrophenyl)sulfanyl-8-oxabicyclo[3.2.1]octan-2-one (PubChem CID 134922319) has the molecular formula C13H11ClN2O6S and a molecular weight of 358.76 g/mol. Its IUPAC name is (1S,5R,6R,7R)-7-chloro-6-(2,4-dinitrophenyl)sulfanyl-8-oxabicyclo[3.2.1]octan-2-one.
| Compound Name | (1S,5R,6R,7R)-7-chloro-6-(2,4-dinitrophenyl)sulfanyl-8-oxabicyclo[3.2.1]octan-2-one |
|---|---|
| PubChem CID | 134922319 |
| Molecular Formula | C13H11ClN2O6S |
| Molecular Weight | 358.76 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | (1S,5R,6R,7R)-7-chloro-6-(2,4-dinitrophenyl)sulfanyl-8-oxabicyclo[3.2.1]octan-2-one |
| SMILES | O=C1CC[C@H]2O[C@@H]1[C@@H](Cl)[C@@H]2Sc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H11ClN2O6S/c14-11-12-8(17)2-3-9(22-12)13(11)23-10-4-1-6(15(18)19)5-7(10)16(20)21/h1,4-5,9,11-13H,2-3H2/t9-,11-,12+,13-/m1/s1 |
| InChIKey | DQCRETLTWZAIBM-FOUMNBMASA-N |
| XLogP | 2.70 |
| TPSA | 112.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.76 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|