C14H13ClN2O5S — CID 23240379
(1R,3S,4S,5S)-3-chloro-4-(2,4-dinitrophenyl)sulfanylbicyclo[3.2.1]octan-6-one (PubChem CID 23240379) has the molecular formula C14H13ClN2O5S and a molecular weight of 356.79 g/mol. Its IUPAC name is (1R,3S,4S,5S)-3-chloro-4-(2,4-dinitrophenyl)sulfanylbicyclo[3.2.1]octan-6-one.
| Compound Name | (1R,3S,4S,5S)-3-chloro-4-(2,4-dinitrophenyl)sulfanylbicyclo[3.2.1]octan-6-one |
|---|---|
| PubChem CID | 23240379 |
| Molecular Formula | C14H13ClN2O5S |
| Molecular Weight | 356.79 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | (1R,3S,4S,5S)-3-chloro-4-(2,4-dinitrophenyl)sulfanylbicyclo[3.2.1]octan-6-one |
| SMILES | O=C1C[C@@H]2C[C@H](Cl)[C@@H](Sc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])[C@H]1C2 |
| InChI | InChI=1S/C14H13ClN2O5S/c15-10-4-7-3-9(12(18)5-7)14(10)23-13-2-1-8(16(19)20)6-11(13)17(21)22/h1-2,6-7,9-10,14H,3-5H2/t7-,9-,10-,14-/m0/s1 |
| InChIKey | PYAUWXQHAVUROS-XPXLTNGVSA-N |
| XLogP | 3.57 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.79 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|