C15H19N3O4S2 — CID 7583953
[(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] pyrrolidine-1-carbodithioate (PubChem CID 7583953) has the molecular formula C15H19N3O4S2 and a molecular weight of 369.47 g/mol. Its IUPAC name is [(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] pyrrolidine-1-carbodithioate.
| Compound Name | [(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 7583953 |
| Molecular Formula | C15H19N3O4S2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | [(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] pyrrolidine-1-carbodithioate |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)[C@H](C)SC(=S)N1CCCC1 |
| InChI | InChI=1S/C15H19N3O4S2/c1-10(24-15(23)17-7-3-4-8-17)14(19)16-12-9-11(18(20)21)5-6-13(12)22-2/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,16,19)/t10-/m0/s1 |
| InChIKey | STEHAKJEZQTOGT-JTQLQIEISA-N |
| XLogP | 3.04 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|