C14H18N2O6S — CID 8766037
methyl 3-[(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]sulfanylpropanoate (PubChem CID 8766037) has the molecular formula C14H18N2O6S and a molecular weight of 342.37 g/mol. Its IUPAC name is methyl 3-[(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]sulfanylpropanoate.
| Compound Name | methyl 3-[(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]sulfanylpropanoate |
|---|---|
| PubChem CID | 8766037 |
| Molecular Formula | C14H18N2O6S |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | methyl 3-[(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]sulfanylpropanoate |
| SMILES | COC(=O)CCS[C@@H](C)C(=O)Nc1cc([N+](=O)[O-])ccc1OC |
| InChI | InChI=1S/C14H18N2O6S/c1-9(23-7-6-13(17)22-3)14(18)15-11-8-10(16(19)20)4-5-12(11)21-2/h4-5,8-9H,6-7H2,1-3H3,(H,15,18)/t9-/m0/s1 |
| InChIKey | YROOBEHPSKKFPJ-VIFPVBQESA-N |
| XLogP | 2.23 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|