C17H26N4O5 — CID 97221207
(2S)-2-[4-[(2S)-1-hydroxypropan-2-yl]piperazin-1-yl]-N-(2-methoxy-5-nitrophenyl)propanamide (PubChem CID 97221207) has the molecular formula C17H26N4O5 and a molecular weight of 366.42 g/mol. Its IUPAC name is (2S)-2-[4-[(2S)-1-hydroxypropan-2-yl]piperazin-1-yl]-N-(2-methoxy-5-nitrophenyl)propanamide.
| Compound Name | (2S)-2-[4-[(2S)-1-hydroxypropan-2-yl]piperazin-1-yl]-N-(2-methoxy-5-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 97221207 |
| Molecular Formula | C17H26N4O5 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | (2S)-2-[4-[(2S)-1-hydroxypropan-2-yl]piperazin-1-yl]-N-(2-methoxy-5-nitrophenyl)propanamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)[C@H](C)N1CCN([C@@H](C)CO)CC1 |
| InChI | InChI=1S/C17H26N4O5/c1-12(11-22)19-6-8-20(9-7-19)13(2)17(23)18-15-10-14(21(24)25)4-5-16(15)26-3/h4-5,10,12-13,22H,6-9,11H2,1-3H3,(H,18,23)/t12-,13-/m0/s1 |
| InChIKey | SHCZFPGBEHKIOQ-STQMWFEESA-N |
| XLogP | 0.93 |
| TPSA | 108.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|