C22H23F2N3O5 — CID 55842357
2-[4-(2,5-difluorobenzoyl)piperidin-1-yl]-N-(2-methoxy-5-nitrophenyl)propanamide (PubChem CID 55842357) has the molecular formula C22H23F2N3O5 and a molecular weight of 447.44 g/mol. Its IUPAC name is 2-[4-(2,5-difluorobenzoyl)piperidin-1-yl]-N-(2-methoxy-5-nitrophenyl)propanamide.
| Compound Name | 2-[4-(2,5-difluorobenzoyl)piperidin-1-yl]-N-(2-methoxy-5-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 55842357 |
| Molecular Formula | C22H23F2N3O5 |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 2-[4-(2,5-difluorobenzoyl)piperidin-1-yl]-N-(2-methoxy-5-nitrophenyl)propanamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)C(C)N1CCC(C(=O)c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C22H23F2N3O5/c1-13(22(29)25-19-12-16(27(30)31)4-6-20(19)32-2)26-9-7-14(8-10-26)21(28)17-11-15(23)3-5-18(17)24/h3-6,11-14H,7-10H2,1-2H3,(H,25,29) |
| InChIKey | YQPLTBSZHMGTQC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|