C25H30F2N2O2 — CID 55738263
N-(4-tert-butylphenyl)-2-[4-(2,5-difluorobenzoyl)piperidin-1-yl]propanamide (PubChem CID 55738263) has the molecular formula C25H30F2N2O2 and a molecular weight of 428.52 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-2-[4-(2,5-difluorobenzoyl)piperidin-1-yl]propanamide.
| Compound Name | N-(4-tert-butylphenyl)-2-[4-(2,5-difluorobenzoyl)piperidin-1-yl]propanamide |
|---|---|
| PubChem CID | 55738263 |
| Molecular Formula | C25H30F2N2O2 |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | N-(4-tert-butylphenyl)-2-[4-(2,5-difluorobenzoyl)piperidin-1-yl]propanamide |
| SMILES | CC(C(=O)Nc1ccc(C(C)(C)C)cc1)N1CCC(C(=O)c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C25H30F2N2O2/c1-16(24(31)28-20-8-5-18(6-9-20)25(2,3)4)29-13-11-17(12-14-29)23(30)21-15-19(26)7-10-22(21)27/h5-10,15-17H,11-14H2,1-4H3,(H,28,31) |
| InChIKey | SGPJVQYEGYNXQE-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |