C21H31N5O5 — CID 167805562
1-[4-[1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]piperazin-1-yl]cyclohexane-1-carboxamide (PubChem CID 167805562) has the molecular formula C21H31N5O5 and a molecular weight of 433.51 g/mol. Its IUPAC name is 1-[4-[1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]piperazin-1-yl]cyclohexane-1-carboxamide.
| Compound Name | 1-[4-[1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]piperazin-1-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 167805562 |
| Molecular Formula | C21H31N5O5 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | 1-[4-[1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl]piperazin-1-yl]cyclohexane-1-carboxamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)C(C)N1CCN(C2(C(N)=O)CCCCC2)CC1 |
| InChI | InChI=1S/C21H31N5O5/c1-15(19(27)23-17-14-16(26(29)30)6-7-18(17)31-2)24-10-12-25(13-11-24)21(20(22)28)8-4-3-5-9-21/h6-7,14-15H,3-5,8-13H2,1-2H3,(H2,22,28)(H,23,27) |
| InChIKey | JVQUBMOWQIOAMP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 131.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|