C20H26N4O4S — CID 47535135
N-(2-methoxy-5-nitrophenyl)-2-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]propanamide (PubChem CID 47535135) has the molecular formula C20H26N4O4S and a molecular weight of 418.52 g/mol. Its IUPAC name is N-(2-methoxy-5-nitrophenyl)-2-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]propanamide.
| Compound Name | N-(2-methoxy-5-nitrophenyl)-2-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 47535135 |
| Molecular Formula | C20H26N4O4S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | N-(2-methoxy-5-nitrophenyl)-2-[4-(2-thiophen-2-ylethyl)piperazin-1-yl]propanamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)C(C)N1CCN(CCc2cccs2)CC1 |
| InChI | InChI=1S/C20H26N4O4S/c1-15(20(25)21-18-14-16(24(26)27)5-6-19(18)28-2)23-11-9-22(10-12-23)8-7-17-4-3-13-29-17/h3-6,13-15H,7-12H2,1-2H3,(H,21,25) |
| InChIKey | MRYSOXJEAXVOGQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|