C12H7F3N4O4S — CID 126389994
2-(2,4-dinitrophenyl)sulfanyl-4-methyl-6-(trifluoromethyl)pyrimidine (PubChem CID 126389994) has the molecular formula C12H7F3N4O4S and a molecular weight of 360.27 g/mol. Its IUPAC name is 2-(2,4-dinitrophenyl)sulfanyl-4-methyl-6-(trifluoromethyl)pyrimidine.
| Compound Name | 2-(2,4-dinitrophenyl)sulfanyl-4-methyl-6-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 126389994 |
| Molecular Formula | C12H7F3N4O4S |
| Molecular Weight | 360.27 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 2-(2,4-dinitrophenyl)sulfanyl-4-methyl-6-(trifluoromethyl)pyrimidine |
| SMILES | Cc1cc(C(F)(F)F)nc(Sc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C12H7F3N4O4S/c1-6-4-10(12(13,14)15)17-11(16-6)24-9-3-2-7(18(20)21)5-8(9)19(22)23/h2-5H,1H3 |
| InChIKey | LUJMLHSDLSLVIN-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 112.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.27 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|