C9H4FN5O4S — CID 54412108
2-(2,4-dinitrophenyl)sulfanyl-4-fluoro-1,3,5-triazine (PubChem CID 54412108) has the molecular formula C9H4FN5O4S and a molecular weight of 297.23 g/mol. Its IUPAC name is 2-(2,4-dinitrophenyl)sulfanyl-4-fluoro-1,3,5-triazine.
| Compound Name | 2-(2,4-dinitrophenyl)sulfanyl-4-fluoro-1,3,5-triazine |
|---|---|
| PubChem CID | 54412108 |
| Molecular Formula | C9H4FN5O4S |
| Molecular Weight | 297.23 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | 2-(2,4-dinitrophenyl)sulfanyl-4-fluoro-1,3,5-triazine |
| SMILES | O=[N+]([O-])c1ccc(Sc2ncnc(F)n2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H4FN5O4S/c10-8-11-4-12-9(13-8)20-7-2-1-5(14(16)17)3-6(7)15(18)19/h1-4H |
| InChIKey | CRQCEQHKUXMXOW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 124.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.23 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|