C15H13N7O2S — CID 73362660
1-[4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-nitrophenyl]-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 73362660) has the molecular formula C15H13N7O2S and a molecular weight of 355.38 g/mol. Its IUPAC name is 1-[4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-nitrophenyl]-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | 1-[4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-nitrophenyl]-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 73362660 |
| Molecular Formula | C15H13N7O2S |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 1-[4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-nitrophenyl]-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | Cc1cc(C)nc(Sc2ccc(C=Nn3cnnc3)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C15H13N7O2S/c1-10-5-11(2)20-15(19-10)25-14-4-3-12(6-13(14)22(23)24)7-18-21-8-16-17-9-21/h3-9H,1-2H3 |
| InChIKey | QVVQPBSKOGIZCV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 111.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|