C19H15BrN4O2S — CID 126117687
N-(3-bromophenyl)-1-[4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-nitrophenyl]methanimine (PubChem CID 126117687) has the molecular formula C19H15BrN4O2S and a molecular weight of 443.33 g/mol. Its IUPAC name is N-(3-bromophenyl)-1-[4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-nitrophenyl]methanimine.
| Compound Name | N-(3-bromophenyl)-1-[4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-nitrophenyl]methanimine |
|---|---|
| PubChem CID | 126117687 |
| Molecular Formula | C19H15BrN4O2S |
| Molecular Weight | 443.33 g/mol |
| Exact Mass | 442.01 |
| IUPAC Name | N-(3-bromophenyl)-1-[4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-nitrophenyl]methanimine |
| SMILES | Cc1cc(C)nc(Sc2ccc(/C=N/c3cccc(Br)c3)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C19H15BrN4O2S/c1-12-8-13(2)23-19(22-12)27-18-7-6-14(9-17(18)24(25)26)11-21-16-5-3-4-15(20)10-16/h3-11H,1-2H3/b21-11+ |
| InChIKey | ACZXQIUGBGAMFC-SRZZPIQSSA-N |
| XLogP | 5.67 |
| TPSA | 81.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.33 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|