C16H11N5O2S — CID 18774429
2-[[4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-nitrophenyl]methylidene]propanedinitrile (PubChem CID 18774429) has the molecular formula C16H11N5O2S and a molecular weight of 337.36 g/mol. Its IUPAC name is 2-[[4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-nitrophenyl]methylidene]propanedinitrile.
| Compound Name | 2-[[4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-nitrophenyl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 18774429 |
| Molecular Formula | C16H11N5O2S |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 2-[[4-(4,6-dimethylpyrimidin-2-yl)sulfanyl-3-nitrophenyl]methylidene]propanedinitrile |
| SMILES | Cc1cc(C)nc(Sc2ccc(C=C(C#N)C#N)cc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C16H11N5O2S/c1-10-5-11(2)20-16(19-10)24-15-4-3-12(6-13(8-17)9-18)7-14(15)21(22)23/h3-7H,1-2H3 |
| InChIKey | ZAJNMBUASYFWGI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 116.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|