C10H9N5O2 — CID 5341225
(E)-1-(4-methyl-3-nitrophenyl)-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 5341225) has the molecular formula C10H9N5O2 and a molecular weight of 231.22 g/mol. Its IUPAC name is (E)-1-(4-methyl-3-nitrophenyl)-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | (E)-1-(4-methyl-3-nitrophenyl)-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 5341225 |
| Molecular Formula | C10H9N5O2 |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | (E)-1-(4-methyl-3-nitrophenyl)-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | Cc1ccc(/C=N/n2cnnc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H9N5O2/c1-8-2-3-9(4-10(8)15(16)17)5-13-14-6-11-12-7-14/h2-7H,1H3/b13-5+ |
| InChIKey | SFNGTHSLYRLULH-WLRTZDKTSA-N |
| XLogP | 1.38 |
| TPSA | 86.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|