C12H10N8O2S — CID 21381290
(E)-1-[4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]-N-(1,2,4-triazol-4-yl)methanimine (PubChem CID 21381290) has the molecular formula C12H10N8O2S and a molecular weight of 330.33 g/mol. Its IUPAC name is (E)-1-[4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]-N-(1,2,4-triazol-4-yl)methanimine.
| Compound Name | (E)-1-[4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]-N-(1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 21381290 |
| Molecular Formula | C12H10N8O2S |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | (E)-1-[4-[(5-methyl-1H-1,2,4-triazol-3-yl)sulfanyl]-3-nitrophenyl]-N-(1,2,4-triazol-4-yl)methanimine |
| SMILES | Cc1nc(Sc2ccc(/C=N/n3cnnc3)cc2[N+](=O)[O-])n[nH]1 |
| InChI | InChI=1S/C12H10N8O2S/c1-8-16-12(18-17-8)23-11-3-2-9(4-10(11)20(21)22)5-15-19-6-13-14-7-19/h2-7H,1H3,(H,16,17,18)/b15-5+ |
| InChIKey | OBPXKFNKIOQIJN-PJQLUOCWSA-N |
| XLogP | 1.65 |
| TPSA | 127.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|