About aniline;1-bromo-3,5-dinitrobenzene
aniline;1-bromo-3,5-dinitrobenzene (PubChem CID 175293083) has the molecular formula C12H10BrN3O4
and a molecular weight of 340.13 g/mol. Its IUPAC name is aniline;1-bromo-3,5-dinitrobenzene.
Molecular Properties
| Compound Name | aniline;1-bromo-3,5-dinitrobenzene |
| PubChem CID | 175293083 |
| Molecular Formula | C12H10BrN3O4 |
| Molecular Weight | 340.13 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | aniline;1-bromo-3,5-dinitrobenzene |
| SMILES | Nc1ccccc1.O=[N+]([O-])c1cc(Br)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H3BrN2O4.C6H7N/c7-4-1-5(8(10)11)3-6(2-4)9(12)13;7-6-4-2-1-3-5-6/h1-3H;1-5H,7H2 |
| InChIKey | HQTLZEUYIHUMSX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 112.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.13 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze aniline;1-bromo-3,5-dinitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;1-bromo-3,5-dinitrobenzene?
The IUPAC name of aniline;1-bromo-3,5-dinitrobenzene (CID 175293083) is aniline;1-bromo-3,5-dinitrobenzene.
What is the SMILES notation for aniline;1-bromo-3,5-dinitrobenzene?
The canonical SMILES for aniline;1-bromo-3,5-dinitrobenzene is Nc1ccccc1.O=[N+]([O-])c1cc(Br)cc([N+](=O)[O-])c1.
What is the InChIKey of aniline;1-bromo-3,5-dinitrobenzene?
The InChIKey is HQTLZEUYIHUMSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3BrN2O4.C6H7N/c7-4-1-5(8(10)11)3-6(2-4)9(12)13;7-6-4-2-1-3-5-6/h1-3H;1-5H,7H2.
What are the key properties of aniline;1-bromo-3,5-dinitrobenzene?
aniline;1-bromo-3,5-dinitrobenzene has a molecular weight of 340.13 g/mol, XLogP of 3.53, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;1-bromo-3,5-dinitrobenzene is sourced from PubChem (CID 175293083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).