C20H16ClN3O2S — CID 108515097
N-(4-amino-3-chlorophenyl)-N'-(2-phenylsulfanylphenyl)oxamide (PubChem CID 108515097) has the molecular formula C20H16ClN3O2S and a molecular weight of 397.89 g/mol. Its IUPAC name is N-(4-amino-3-chlorophenyl)-N'-(2-phenylsulfanylphenyl)oxamide.
| Compound Name | N-(4-amino-3-chlorophenyl)-N'-(2-phenylsulfanylphenyl)oxamide |
|---|---|
| PubChem CID | 108515097 |
| Molecular Formula | C20H16ClN3O2S |
| Molecular Weight | 397.89 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | N-(4-amino-3-chlorophenyl)-N'-(2-phenylsulfanylphenyl)oxamide |
| SMILES | Nc1ccc(NC(=O)C(=O)Nc2ccccc2Sc2ccccc2)cc1Cl |
| InChI | InChI=1S/C20H16ClN3O2S/c21-15-12-13(10-11-16(15)22)23-19(25)20(26)24-17-8-4-5-9-18(17)27-14-6-2-1-3-7-14/h1-12H,22H2,(H,23,25)(H,24,26) |
| InChIKey | SDHSIYKFHRHXAI-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.89 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|