C21H17ClN2O3S — CID 108501172
N-(3-chloro-4-methoxyphenyl)-N'-(2-phenylsulfanylphenyl)oxamide (PubChem CID 108501172) has the molecular formula C21H17ClN2O3S and a molecular weight of 412.90 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-N'-(2-phenylsulfanylphenyl)oxamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-N'-(2-phenylsulfanylphenyl)oxamide |
|---|---|
| PubChem CID | 108501172 |
| Molecular Formula | C21H17ClN2O3S |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-N'-(2-phenylsulfanylphenyl)oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)Nc2ccccc2Sc2ccccc2)cc1Cl |
| InChI | InChI=1S/C21H17ClN2O3S/c1-27-18-12-11-14(13-16(18)22)23-20(25)21(26)24-17-9-5-6-10-19(17)28-15-7-3-2-4-8-15/h2-13H,1H3,(H,23,25)(H,24,26) |
| InChIKey | KAWZJOZWTQVHDU-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|