C34H38O4 — CID 57142110
2,6-bis(4-hexylphenyl)-5,8-dihydroxynaphthalene-1,4-dione (PubChem CID 57142110) has the molecular formula C34H38O4 and a molecular weight of 510.67 g/mol. Its IUPAC name is 2,6-bis(4-hexylphenyl)-5,8-dihydroxynaphthalene-1,4-dione.
| Compound Name | 2,6-bis(4-hexylphenyl)-5,8-dihydroxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 57142110 |
| Molecular Formula | C34H38O4 |
| Molecular Weight | 510.67 g/mol |
| Exact Mass | 510.28 |
| IUPAC Name | 2,6-bis(4-hexylphenyl)-5,8-dihydroxynaphthalene-1,4-dione |
| SMILES | CCCCCCc1ccc(C2=CC(=O)c3c(O)c(-c4ccc(CCCCCC)cc4)cc(O)c3C2=O)cc1 |
| InChI | InChI=1S/C34H38O4/c1-3-5-7-9-11-23-13-17-25(18-14-23)27-21-29(35)32-31(33(27)37)30(36)22-28(34(32)38)26-19-15-24(16-20-26)12-10-8-6-4-2/h13-22,35,37H,3-12H2,1-2H3 |
| InChIKey | JIADHDVLVAMPGF-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.67 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_D(1)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|