C17H20O2 — CID 70366115
3-(4-pentylphenyl)benzene-1,2-diol (PubChem CID 70366115) has the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. Its IUPAC name is 3-(4-pentylphenyl)benzene-1,2-diol.
| Compound Name | 3-(4-pentylphenyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 70366115 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 3-(4-pentylphenyl)benzene-1,2-diol |
| SMILES | CCCCCc1ccc(-c2cccc(O)c2O)cc1 |
| InChI | InChI=1S/C17H20O2/c1-2-3-4-6-13-9-11-14(12-10-13)15-7-5-8-16(18)17(15)19/h5,7-12,18-19H,2-4,6H2,1H3 |
| InChIKey | VOFMJSCCPYAUPX-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|