C19H24O2 — CID 175313159
1,2-dimethoxy-3-(4-pentylphenyl)benzene (PubChem CID 175313159) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is 1,2-dimethoxy-3-(4-pentylphenyl)benzene.
| Compound Name | 1,2-dimethoxy-3-(4-pentylphenyl)benzene |
|---|---|
| PubChem CID | 175313159 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 1,2-dimethoxy-3-(4-pentylphenyl)benzene |
| SMILES | CCCCCc1ccc(-c2cccc(OC)c2OC)cc1 |
| InChI | InChI=1S/C19H24O2/c1-4-5-6-8-15-11-13-16(14-12-15)17-9-7-10-18(20-2)19(17)21-3/h7,9-14H,4-6,8H2,1-3H3 |
| InChIKey | JJOXMMWTBZTOHX-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|