C24H26O4S — CID 54218381
5,8-dihydroxy-2-(4-octylphenyl)sulfanylnaphthalene-1,4-dione (PubChem CID 54218381) has the molecular formula C24H26O4S and a molecular weight of 410.54 g/mol. Its IUPAC name is 5,8-dihydroxy-2-(4-octylphenyl)sulfanylnaphthalene-1,4-dione.
| Compound Name | 5,8-dihydroxy-2-(4-octylphenyl)sulfanylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 54218381 |
| Molecular Formula | C24H26O4S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 5,8-dihydroxy-2-(4-octylphenyl)sulfanylnaphthalene-1,4-dione |
| SMILES | CCCCCCCCc1ccc(SC2=CC(=O)c3c(O)ccc(O)c3C2=O)cc1 |
| InChI | InChI=1S/C24H26O4S/c1-2-3-4-5-6-7-8-16-9-11-17(12-10-16)29-21-15-20(27)22-18(25)13-14-19(26)23(22)24(21)28/h9-15,25-26H,2-8H2,1H3 |
| InChIKey | QATYTPVDSBXDIX-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|