C16H8Cl2O2S — CID 19909004
2-chloro-5-(3-chlorophenyl)sulfanylnaphthalene-1,4-dione (PubChem CID 19909004) has the molecular formula C16H8Cl2O2S and a molecular weight of 335.21 g/mol. Its IUPAC name is 2-chloro-5-(3-chlorophenyl)sulfanylnaphthalene-1,4-dione.
| Compound Name | 2-chloro-5-(3-chlorophenyl)sulfanylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 19909004 |
| Molecular Formula | C16H8Cl2O2S |
| Molecular Weight | 335.21 g/mol |
| Exact Mass | 333.96 |
| IUPAC Name | 2-chloro-5-(3-chlorophenyl)sulfanylnaphthalene-1,4-dione |
| SMILES | O=C1C(Cl)=CC(=O)c2c(Sc3cccc(Cl)c3)cccc21 |
| InChI | InChI=1S/C16H8Cl2O2S/c17-9-3-1-4-10(7-9)21-14-6-2-5-11-15(14)13(19)8-12(18)16(11)20/h1-8H |
| InChIKey | ZXALRAXZIJBLSM-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.21 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|