C26H14Cl2O3S2 — CID 70349400
1,4-bis[(4-chlorophenyl)sulfanyl]-5-hydroxyanthracene-9,10-dione (PubChem CID 70349400) has the molecular formula C26H14Cl2O3S2 and a molecular weight of 509.44 g/mol. Its IUPAC name is 1,4-bis[(4-chlorophenyl)sulfanyl]-5-hydroxyanthracene-9,10-dione.
| Compound Name | 1,4-bis[(4-chlorophenyl)sulfanyl]-5-hydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 70349400 |
| Molecular Formula | C26H14Cl2O3S2 |
| Molecular Weight | 509.44 g/mol |
| Exact Mass | 507.98 |
| IUPAC Name | 1,4-bis[(4-chlorophenyl)sulfanyl]-5-hydroxyanthracene-9,10-dione |
| SMILES | O=C1c2cccc(O)c2C(=O)c2c(Sc3ccc(Cl)cc3)ccc(Sc3ccc(Cl)cc3)c21 |
| InChI | InChI=1S/C26H14Cl2O3S2/c27-14-4-8-16(9-5-14)32-20-12-13-21(33-17-10-6-15(28)7-11-17)24-23(20)25(30)18-2-1-3-19(29)22(18)26(24)31/h1-13,29H |
| InChIKey | ZFXSSTWOOKZTCK-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.44 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|