C16H12N4O2 — CID 152601753
9,10-dioxoanthracene-2,3-dicarboximidamide (PubChem CID 152601753) has the molecular formula C16H12N4O2 and a molecular weight of 292.30 g/mol. Its IUPAC name is 9,10-dioxoanthracene-2,3-dicarboximidamide.
| Compound Name | 9,10-dioxoanthracene-2,3-dicarboximidamide |
|---|---|
| PubChem CID | 152601753 |
| Molecular Formula | C16H12N4O2 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 9,10-dioxoanthracene-2,3-dicarboximidamide |
| SMILES | [H]/N=C(\N)c1cc2c(cc1/C(N)=N/[H])C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C16H12N4O2/c17-15(18)11-5-9-10(6-12(11)16(19)20)14(22)8-4-2-1-3-7(8)13(9)21/h1-6H,(H3,17,18)(H3,19,20) |
| InChIKey | YXRJIOVKJJICSN-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 133.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|