C13H11NO4 — CID 135516249
3-[(1-hydroxy-3-oxoinden-2-yl)methylideneamino]propanoic acid (PubChem CID 135516249) has the molecular formula C13H11NO4 and a molecular weight of 245.23 g/mol. Its IUPAC name is 3-[(1-hydroxy-3-oxoinden-2-yl)methylideneamino]propanoic acid.
| Compound Name | 3-[(1-hydroxy-3-oxoinden-2-yl)methylideneamino]propanoic acid |
|---|---|
| PubChem CID | 135516249 |
| Molecular Formula | C13H11NO4 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 3-[(1-hydroxy-3-oxoinden-2-yl)methylideneamino]propanoic acid |
| SMILES | O=C(O)CC/N=C/C1=C(O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H11NO4/c15-11(16)5-6-14-7-10-12(17)8-3-1-2-4-9(8)13(10)18/h1-4,7,17H,5-6H2,(H,15,16)/b14-7+ |
| InChIKey | JXOUQYKSGXRAHM-VGOFMYFVSA-N |
| XLogP | 1.70 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|