C18H13NO4 — CID 135441636
4-[[(1-hydroxy-3-oxoinden-2-yl)methylideneamino]methyl]benzoic acid (PubChem CID 135441636) has the molecular formula C18H13NO4 and a molecular weight of 307.31 g/mol. Its IUPAC name is 4-[[(1-hydroxy-3-oxoinden-2-yl)methylideneamino]methyl]benzoic acid.
| Compound Name | 4-[[(1-hydroxy-3-oxoinden-2-yl)methylideneamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 135441636 |
| Molecular Formula | C18H13NO4 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 4-[[(1-hydroxy-3-oxoinden-2-yl)methylideneamino]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C/N=C/C2=C(O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C18H13NO4/c20-16-13-3-1-2-4-14(13)17(21)15(16)10-19-9-11-5-7-12(8-6-11)18(22)23/h1-8,10,20H,9H2,(H,22,23)/b19-10+ |
| InChIKey | BCBIEISMESHZHL-VXLYETTFSA-N |
| XLogP | 3.12 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|