C17H19NO4 — CID 135441968
4-[[(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methylideneamino]methyl]benzoic acid (PubChem CID 135441968) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is 4-[[(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methylideneamino]methyl]benzoic acid.
| Compound Name | 4-[[(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methylideneamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 135441968 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 4-[[(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methylideneamino]methyl]benzoic acid |
| SMILES | CC1(C)CC(=O)C(/C=N/Cc2ccc(C(=O)O)cc2)=C(O)C1 |
| InChI | InChI=1S/C17H19NO4/c1-17(2)7-14(19)13(15(20)8-17)10-18-9-11-3-5-12(6-4-11)16(21)22/h3-6,10,19H,7-9H2,1-2H3,(H,21,22)/b18-10+ |
| InChIKey | FIPHVNVMSCXBJG-VCHYOVAHSA-N |
| XLogP | 3.16 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|