C25H28N2O6 — CID 135465739
3,4-bis[(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methylideneamino]benzoic acid (PubChem CID 135465739) has the molecular formula C25H28N2O6 and a molecular weight of 452.51 g/mol. Its IUPAC name is 3,4-bis[(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methylideneamino]benzoic acid.
| Compound Name | 3,4-bis[(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methylideneamino]benzoic acid |
|---|---|
| PubChem CID | 135465739 |
| Molecular Formula | C25H28N2O6 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.19 |
| IUPAC Name | 3,4-bis[(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methylideneamino]benzoic acid |
| SMILES | CC1(C)CC(=O)C(/C=N/c2ccc(C(=O)O)cc2/N=C/C2=C(O)CC(C)(C)CC2=O)=C(O)C1 |
| InChI | InChI=1S/C25H28N2O6/c1-24(2)8-19(28)15(20(29)9-24)12-26-17-6-5-14(23(32)33)7-18(17)27-13-16-21(30)10-25(3,4)11-22(16)31/h5-7,12-13,28,30H,8-11H2,1-4H3,(H,32,33)/b26-12+,27-13+ |
| InChIKey | PCOBXAIAYKVWMJ-JCAXBWHZSA-N |
| XLogP | 5.19 |
| TPSA | 136.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|