C15H23NO4 — CID 136765091
(2R)-2-[(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methylideneamino]-4-methylpentanoic acid (PubChem CID 136765091) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is (2R)-2-[(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methylideneamino]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methylideneamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 136765091 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | (2R)-2-[(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methylideneamino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@@H](/N=C/C1=C(O)CC(C)(C)CC1=O)C(=O)O |
| InChI | InChI=1S/C15H23NO4/c1-9(2)5-11(14(19)20)16-8-10-12(17)6-15(3,4)7-13(10)18/h8-9,11,17H,5-7H2,1-4H3,(H,19,20)/b16-8+/t11-/m1/s1 |
| InChIKey | QWTHVDJQQAWBPT-FNQVVVRFSA-N |
| XLogP | 2.76 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|