C16H25NO4 — CID 140925239
(2S)-2-[1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)ethylideneamino]-4-methylpentanoic acid (PubChem CID 140925239) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is (2S)-2-[1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)ethylideneamino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)ethylideneamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 140925239 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | (2S)-2-[1-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)ethylideneamino]-4-methylpentanoic acid |
| SMILES | C/C(=N\[C@@H](CC(C)C)C(=O)O)C1=C(O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C16H25NO4/c1-9(2)6-11(15(20)21)17-10(3)14-12(18)7-16(4,5)8-13(14)19/h9,11,18H,6-8H2,1-5H3,(H,20,21)/b17-10+/t11-/m0/s1 |
| InChIKey | QTZBKGFVZQDIGR-MUOOZZNISA-N |
| XLogP | 3.15 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|