C17H26O4 — CID 149073076
(2R)-2-[2-(4,4-dimethyl-2,6-dioxocyclohexylidene)propyl]-4-methylpentanoic acid (PubChem CID 149073076) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is (2R)-2-[2-(4,4-dimethyl-2,6-dioxocyclohexylidene)propyl]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[2-(4,4-dimethyl-2,6-dioxocyclohexylidene)propyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 149073076 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | (2R)-2-[2-(4,4-dimethyl-2,6-dioxocyclohexylidene)propyl]-4-methylpentanoic acid |
| SMILES | CC(C[C@@H](CC(C)C)C(=O)O)=C1C(=O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C17H26O4/c1-10(2)6-12(16(20)21)7-11(3)15-13(18)8-17(4,5)9-14(15)19/h10,12H,6-9H2,1-5H3,(H,20,21)/t12-/m1/s1 |
| InChIKey | QOJGZJLVNGXDHS-GFCCVEGCSA-N |
| XLogP | 3.40 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|